C18H12F7N — CID 59157184
1-(9H-fluoren-3-yl)-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine (PubChem CID 59157184) has the molecular formula C18H12F7N and a molecular weight of 375.29 g/mol. Its IUPAC name is 1-(9H-fluoren-3-yl)-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine.
| Compound Name | 1-(9H-fluoren-3-yl)-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine |
|---|---|
| PubChem CID | 59157184 |
| Molecular Formula | C18H12F7N |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-(9H-fluoren-3-yl)-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine |
| SMILES | C/N=C(\c1ccc2c(c1)-c1ccccc1C2)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H12F7N/c1-26-15(16(19,20)17(21,22)18(23,24)25)12-7-6-11-8-10-4-2-3-5-13(10)14(11)9-12/h2-7,9H,8H2,1H3/b26-15+ |
| InChIKey | ZSCQQMAJVIYVBJ-CVKSISIWSA-N |
| XLogP | 5.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|