C16H15F2NO — CID 59157199
2,2-difluoro-N-methyl-1-(4-phenoxyphenyl)propan-1-imine (PubChem CID 59157199) has the molecular formula C16H15F2NO and a molecular weight of 275.30 g/mol. Its IUPAC name is 2,2-difluoro-N-methyl-1-(4-phenoxyphenyl)propan-1-imine.
| Compound Name | 2,2-difluoro-N-methyl-1-(4-phenoxyphenyl)propan-1-imine |
|---|---|
| PubChem CID | 59157199 |
| Molecular Formula | C16H15F2NO |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2,2-difluoro-N-methyl-1-(4-phenoxyphenyl)propan-1-imine |
| SMILES | C/N=C(\c1ccc(Oc2ccccc2)cc1)C(C)(F)F |
| InChI | InChI=1S/C16H15F2NO/c1-16(17,18)15(19-2)12-8-10-14(11-9-12)20-13-6-4-3-5-7-13/h3-11H,1-2H3/b19-15+ |
| InChIKey | GFMRHIKLDJDSRS-XDJHFCHBSA-N |
| XLogP | 4.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|