C21H22F7NO4 — CID 59157222
(4-methyl-5-prop-2-enoyloxypentyl) 4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]benzoate (PubChem CID 59157222) has the molecular formula C21H22F7NO4 and a molecular weight of 485.40 g/mol. Its IUPAC name is (4-methyl-5-prop-2-enoyloxypentyl) 4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]benzoate.
| Compound Name | (4-methyl-5-prop-2-enoyloxypentyl) 4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]benzoate |
|---|---|
| PubChem CID | 59157222 |
| Molecular Formula | C21H22F7NO4 |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (4-methyl-5-prop-2-enoyloxypentyl) 4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]benzoate |
| SMILES | C=CC(=O)OCC(C)CCCOC(=O)c1ccc(/C(=N\C)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F7NO4/c1-4-16(30)33-12-13(2)6-5-11-32-18(31)15-9-7-14(8-10-15)17(29-3)19(22,23)20(24,25)21(26,27)28/h4,7-10,13H,1,5-6,11-12H2,2-3H3/b29-17+ |
| InChIKey | YODVRDZFLDMFOU-STBIYBPSSA-N |
| XLogP | 5.24 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|