C16H10F14N2 — CID 59157241
2,2,3,3,4,4,4-heptafluoro-1-[4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl]-N-methylbutan-1-imine (PubChem CID 59157241) has the molecular formula C16H10F14N2 and a molecular weight of 496.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-[4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl]-N-methylbutan-1-imine.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl]-N-methylbutan-1-imine |
|---|---|
| PubChem CID | 59157241 |
| Molecular Formula | C16H10F14N2 |
| Molecular Weight | 496.24 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl]-N-methylbutan-1-imine |
| SMILES | C/N=C(\c1ccc(/C(=N\C)C(F)(F)C(F)(F)C(F)(F)F)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H10F14N2/c1-31-9(11(17,18)13(21,22)15(25,26)27)7-3-5-8(6-4-7)10(32-2)12(19,20)14(23,24)16(28,29)30/h3-6H,1-2H3/b31-9+,32-10+ |
| InChIKey | PAUWOYYBJCJJNJ-BQVZVJNFSA-N |
| XLogP | 6.19 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.24 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|