C22H18F7NO2 — CID 59157245
[4-[4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 59157245) has the molecular formula C22H18F7NO2 and a molecular weight of 461.38 g/mol. Its IUPAC name is [4-[4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59157245 |
| Molecular Formula | C22H18F7NO2 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [4-[4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc(-c2ccc(/C(=N\C)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H18F7NO2/c1-13(2)19(31)32-12-14-4-6-15(7-5-14)16-8-10-17(11-9-16)18(30-3)20(23,24)21(25,26)22(27,28)29/h4-11H,1,12H2,2-3H3/b30-18+ |
| InChIKey | PPSPTQOYEQPRHG-UXHLAJHPSA-N |
| XLogP | 6.22 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|