C28H16F21N3 — CID 59157266
1-[6,8-bis[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]-9H-fluoren-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine (PubChem CID 59157266) has the molecular formula C28H16F21N3 and a molecular weight of 793.41 g/mol. Its IUPAC name is 1-[6,8-bis[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]-9H-fluoren-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine.
| Compound Name | 1-[6,8-bis[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]-9H-fluoren-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine |
|---|---|
| PubChem CID | 59157266 |
| Molecular Formula | C28H16F21N3 |
| Molecular Weight | 793.41 g/mol |
| Exact Mass | 793.10 |
| IUPAC Name | 1-[6,8-bis[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]-9H-fluoren-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine |
| SMILES | C/N=C(/c1ccc2c(c1)Cc1c(/C(=N/C)C(F)(F)C(F)(F)C(F)(F)F)cc(/C(=N/C)C(F)(F)C(F)(F)C(F)(F)F)cc1-2)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H16F21N3/c1-50-17(20(29,30)23(35,36)26(41,42)43)10-4-5-13-11(6-10)7-15-14(13)8-12(18(51-2)21(31,32)24(37,38)27(44,45)46)9-16(15)19(52-3)22(33,34)25(39,40)28(47,48)49/h4-6,8-9H,7H2,1-3H3/b50-17-,51-18-,52-19- |
| InChIKey | QQJZWAUALBFHOI-BPCXCYBASA-N |
| XLogP | 10.01 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.41 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|