C15H10F7N — CID 59157285
2,2,3,3,4,4,4-heptafluoro-N-methyl-1-naphthalen-2-ylbutan-1-imine (PubChem CID 59157285) has the molecular formula C15H10F7N and a molecular weight of 337.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-methyl-1-naphthalen-2-ylbutan-1-imine.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-methyl-1-naphthalen-2-ylbutan-1-imine |
|---|---|
| PubChem CID | 59157285 |
| Molecular Formula | C15H10F7N |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-methyl-1-naphthalen-2-ylbutan-1-imine |
| SMILES | C/N=C(\c1ccc2ccccc2c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H10F7N/c1-23-12(13(16,17)14(18,19)15(20,21)22)11-7-6-9-4-2-3-5-10(9)8-11/h2-8H,1H3/b23-12+ |
| InChIKey | CTPPBITXGWIMHY-FSJBWODESA-N |
| XLogP | 5.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|