C21H17F7N2 — CID 59157334
1-[7-(C,N-dimethylcarbonimidoyl)-9H-fluoren-3-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine (PubChem CID 59157334) has the molecular formula C21H17F7N2 and a molecular weight of 430.37 g/mol. Its IUPAC name is 1-[7-(C,N-dimethylcarbonimidoyl)-9H-fluoren-3-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine.
| Compound Name | 1-[7-(C,N-dimethylcarbonimidoyl)-9H-fluoren-3-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine |
|---|---|
| PubChem CID | 59157334 |
| Molecular Formula | C21H17F7N2 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[7-(C,N-dimethylcarbonimidoyl)-9H-fluoren-3-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine |
| SMILES | C/N=C(\C)c1ccc2c(c1)Cc1ccc(/C(=N\C)C(F)(F)C(F)(F)C(F)(F)F)cc1-2 |
| InChI | InChI=1S/C21H17F7N2/c1-11(29-2)12-6-7-16-15(8-12)9-13-4-5-14(10-17(13)16)18(30-3)19(22,23)20(24,25)21(26,27)28/h4-8,10H,9H2,1-3H3/b29-11+,30-18+ |
| InChIKey | LNPGQCLCELRULL-VGHBBWGVSA-N |
| XLogP | 5.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|