C23H17F14N3 — CID 59157337
1-[6-(C,N-dimethylcarbonimidoyl)-3-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]naphthalen-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine (PubChem CID 59157337) has the molecular formula C23H17F14N3 and a molecular weight of 601.38 g/mol. Its IUPAC name is 1-[6-(C,N-dimethylcarbonimidoyl)-3-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]naphthalen-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine.
| Compound Name | 1-[6-(C,N-dimethylcarbonimidoyl)-3-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]naphthalen-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine |
|---|---|
| PubChem CID | 59157337 |
| Molecular Formula | C23H17F14N3 |
| Molecular Weight | 601.38 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | 1-[6-(C,N-dimethylcarbonimidoyl)-3-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]naphthalen-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-imine |
| SMILES | C/N=C(/c1cc2ccc(/C(C)=N/C)cc2cc1/C(=N/C)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H17F14N3/c1-10(38-2)11-5-6-12-8-14(16(39-3)18(24,25)20(28,29)22(32,33)34)15(9-13(12)7-11)17(40-4)19(26,27)21(30,31)23(35,36)37/h5-9H,1-4H3/b38-10+,39-16-,40-17- |
| InChIKey | JQDBHFXGIOCPEB-VSUQNCDOSA-N |
| XLogP | 7.78 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.38 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|