About 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate
2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate (PubChem CID 59157384) has the molecular formula C20H17F2NO4
and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate |
| PubChem CID | 59157384 |
| Molecular Formula | C20H17F2NO4 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate |
| SMILES | C=CC(=O)OCCOC(=O)c1cccc(/C(=N\C)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C20H17F2NO4/c1-3-17(24)26-10-11-27-20(25)14-7-4-6-13(12-14)19(23-2)18-15(21)8-5-9-16(18)22/h3-9,12H,1,10-11H2,2H3/b23-19+ |
| InChIKey | YAVAWAMMKIJRGI-FCDQGJHFSA-N |
| XLogP | 3.32 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate?
The IUPAC name of 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate (CID 59157384) is 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate?
The canonical SMILES for 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate is C=CC(=O)OCCOC(=O)c1cccc(/C(=N\C)c2c(F)cccc2F)c1.
What is the InChIKey of 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate?
The InChIKey is YAVAWAMMKIJRGI-FCDQGJHFSA-N. The full InChI is InChI=1S/C20H17F2NO4/c1-3-17(24)26-10-11-27-20(25)14-7-4-6-13(12-14)19(23-2)18-15(21)8-5-9-16(18)22/h3-9,12H,1,10-11H2,2H3/b23-19+.
What are the key properties of 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate?
2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate has a molecular weight of 373.36 g/mol, XLogP of 3.32, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate is sourced from PubChem (CID 59157384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).