C14H12F16N2O5 — CID 59157492
2,3,3,3-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-[2-[[3,3,3-trifluoro-2-(1,2,2,2-tetrafluoroethoxy)propanoyl]amino]ethoxy]ethyl]propanamide (PubChem CID 59157492) has the molecular formula C14H12F16N2O5 and a molecular weight of 592.23 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-[2-[[3,3,3-trifluoro-2-(1,2,2,2-tetrafluoroethoxy)propanoyl]amino]ethoxy]ethyl]propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-[2-[[3,3,3-trifluoro-2-(1,2,2,2-tetrafluoroethoxy)propanoyl]amino]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 59157492 |
| Molecular Formula | C14H12F16N2O5 |
| Molecular Weight | 592.23 g/mol |
| Exact Mass | 592.05 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-[2-[[3,3,3-trifluoro-2-(1,2,2,2-tetrafluoroethoxy)propanoyl]amino]ethoxy]ethyl]propanamide |
| SMILES | O=C(NCCOCCNC(=O)C(F)(OC(F)(F)C(F)(F)F)C(F)(F)F)C(OC(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H12F16N2O5/c15-7(11(20,21)22)36-5(10(17,18)19)6(33)31-1-3-35-4-2-32-8(34)9(16,12(23,24)25)37-14(29,30)13(26,27)28/h5,7H,1-4H2,(H,31,33)(H,32,34) |
| InChIKey | YCPBFFSPIIAXQM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|