C16H18N4O7 — CID 59157606
2-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethyl]acetamide (PubChem CID 59157606) has the molecular formula C16H18N4O7 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethyl]acetamide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 59157606 |
| Molecular Formula | C16H18N4O7 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethyl]acetamide |
| SMILES | O=C(CN1C(=O)C=CC1=O)NCCOCCNC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H18N4O7/c21-11(9-19-13(23)1-2-14(19)24)17-5-7-27-8-6-18-12(22)10-20-15(25)3-4-16(20)26/h1-4H,5-10H2,(H,17,21)(H,18,22) |
| InChIKey | BBPPFXPFVGJGKB-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|