About methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate
methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate (PubChem CID 59157725) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate |
| PubChem CID | 59157725 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate |
| SMILES | COC(=O)CC[C@@H]1NC(=O)N(C)C1=O |
| InChI | InChI=1S/C8H12N2O4/c1-10-7(12)5(9-8(10)13)3-4-6(11)14-2/h5H,3-4H2,1-2H3,(H,9,13)/t5-/m0/s1 |
| InChIKey | WLOIAEJFVZXFQY-YFKPBYRVSA-N |
| XLogP | -0.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate?
The IUPAC name of methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate (CID 59157725) is methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate.
What is the SMILES notation for methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate?
The canonical SMILES for methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate is COC(=O)CC[C@@H]1NC(=O)N(C)C1=O.
What is the InChIKey of methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate?
The InChIKey is WLOIAEJFVZXFQY-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-10-7(12)5(9-8(10)13)3-4-6(11)14-2/h5H,3-4H2,1-2H3,(H,9,13)/t5-/m0/s1.
What are the key properties of methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate?
methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate has a molecular weight of 200.19 g/mol, XLogP of -0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(4S)-1-methyl-2,5-dioxoimidazolidin-4-yl]propanoate is sourced from PubChem (CID 59157725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).