C29H39N3O4S — CID 59158051
N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]-3-[2-(2-methylphenyl)ethylamino]-N-(oxan-4-yl)propanamide (PubChem CID 59158051) has the molecular formula C29H39N3O4S and a molecular weight of 525.72 g/mol. Its IUPAC name is N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]-3-[2-(2-methylphenyl)ethylamino]-N-(oxan-4-yl)propanamide.
| Compound Name | N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]-3-[2-(2-methylphenyl)ethylamino]-N-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 59158051 |
| Molecular Formula | C29H39N3O4S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]-3-[2-(2-methylphenyl)ethylamino]-N-(oxan-4-yl)propanamide |
| SMILES | Cc1ccccc1CCNCCC(=O)N(CCCCCc1ccc(O)c2[nH]c(=O)sc12)C1CCOCC1 |
| InChI | InChI=1S/C29H39N3O4S/c1-21-7-4-5-8-22(21)12-16-30-17-13-26(34)32(24-14-19-36-20-15-24)18-6-2-3-9-23-10-11-25(33)27-28(23)37-29(35)31-27/h4-5,7-8,10-11,24,30,33H,2-3,6,9,12-20H2,1H3,(H,31,35) |
| InChIKey | FHMIMJGTCMFGPR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|