C22H21FN2O4 — CID 59158350
ethyl 5-[(4-fluorophenyl)methyl]-9-hydroxy-3,3-dimethyl-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraene-10-carboxylate (PubChem CID 59158350) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is ethyl 5-[(4-fluorophenyl)methyl]-9-hydroxy-3,3-dimethyl-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraene-10-carboxylate.
| Compound Name | ethyl 5-[(4-fluorophenyl)methyl]-9-hydroxy-3,3-dimethyl-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 59158350 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | ethyl 5-[(4-fluorophenyl)methyl]-9-hydroxy-3,3-dimethyl-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraene-10-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)CC3(C)C |
| InChI | InChI=1S/C22H21FN2O4/c1-4-29-21(28)15-19(26)17-18-16(22(2,3)11-25(18)20(15)27)13(10-24-17)9-12-5-7-14(23)8-6-12/h5-8,10,26H,4,9,11H2,1-3H3 |
| InChIKey | PIDBNPZZZWAFBA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |