C25H24FN3O8 — CID 59158365
ethyl (3R)-3-[[(2-ethoxy-2-oxoacetyl)amino]methyl]-6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate (PubChem CID 59158365) has the molecular formula C25H24FN3O8 and a molecular weight of 513.48 g/mol. Its IUPAC name is ethyl (3R)-3-[[(2-ethoxy-2-oxoacetyl)amino]methyl]-6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate.
| Compound Name | ethyl (3R)-3-[[(2-ethoxy-2-oxoacetyl)amino]methyl]-6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 59158365 |
| Molecular Formula | C25H24FN3O8 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | ethyl (3R)-3-[[(2-ethoxy-2-oxoacetyl)amino]methyl]-6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate |
| SMILES | CCOC(=O)C(=O)NC[C@@H]1Cn2c(=O)c(C(=O)OCC)c(O)c3ncc(Cc4ccc(F)cc4)c(c32)O1 |
| InChI | InChI=1S/C25H24FN3O8/c1-3-35-24(33)17-20(30)18-19-21(14(10-27-18)9-13-5-7-15(26)8-6-13)37-16(12-29(19)23(17)32)11-28-22(31)25(34)36-4-2/h5-8,10,16,30H,3-4,9,11-12H2,1-2H3,(H,28,31)/t16-/m1/s1 |
| InChIKey | XDXNIFTWVCKREU-MRXNPFEDSA-N |
| XLogP | 1.45 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|