C24H25FN4O6 — CID 59158409
(3R)-6-[(4-fluorophenyl)methyl]-10-hydroxy-3-N-(2-methoxyethyl)-11-N,3-dimethyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3,11-dicarboxamide (PubChem CID 59158409) has the molecular formula C24H25FN4O6 and a molecular weight of 484.48 g/mol. Its IUPAC name is (3R)-6-[(4-fluorophenyl)methyl]-10-hydroxy-3-N-(2-methoxyethyl)-11-N,3-dimethyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3,11-dicarboxamide.
| Compound Name | (3R)-6-[(4-fluorophenyl)methyl]-10-hydroxy-3-N-(2-methoxyethyl)-11-N,3-dimethyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3,11-dicarboxamide |
|---|---|
| PubChem CID | 59158409 |
| Molecular Formula | C24H25FN4O6 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (3R)-6-[(4-fluorophenyl)methyl]-10-hydroxy-3-N-(2-methoxyethyl)-11-N,3-dimethyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3,11-dicarboxamide |
| SMILES | CNC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)C[C@](C)(C(=O)NCCOC)O3 |
| InChI | InChI=1S/C24H25FN4O6/c1-24(23(33)27-8-9-34-3)12-29-18-17(19(30)16(22(29)32)21(31)26-2)28-11-14(20(18)35-24)10-13-4-6-15(25)7-5-13/h4-7,11,30H,8-10,12H2,1-3H3,(H,26,31)(H,27,33)/t24-/m1/s1 |
| InChIKey | QKGGLSWIUXNEFC-XMMPIXPASA-N |
| XLogP | 1.11 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|