C32H30ClF2N3O7 — CID 59158465
propan-2-yl 5-benzyl-4-chloro-3-[[3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropyl]-(3-ethoxy-3-oxopropanoyl)amino]pyridine-2-carboxylate (PubChem CID 59158465) has the molecular formula C32H30ClF2N3O7 and a molecular weight of 642.06 g/mol. Its IUPAC name is propan-2-yl 5-benzyl-4-chloro-3-[[3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropyl]-(3-ethoxy-3-oxopropanoyl)amino]pyridine-2-carboxylate.
| Compound Name | propan-2-yl 5-benzyl-4-chloro-3-[[3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropyl]-(3-ethoxy-3-oxopropanoyl)amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59158465 |
| Molecular Formula | C32H30ClF2N3O7 |
| Molecular Weight | 642.06 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | propan-2-yl 5-benzyl-4-chloro-3-[[3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropyl]-(3-ethoxy-3-oxopropanoyl)amino]pyridine-2-carboxylate |
| SMILES | CCOC(=O)CC(=O)N(CC(F)(F)CN1C(=O)c2ccccc2C1=O)c1c(C(=O)OC(C)C)ncc(Cc2ccccc2)c1Cl |
| InChI | InChI=1S/C32H30ClF2N3O7/c1-4-44-25(40)15-24(39)37(17-32(34,35)18-38-29(41)22-12-8-9-13-23(22)30(38)42)28-26(33)21(14-20-10-6-5-7-11-20)16-36-27(28)31(43)45-19(2)3/h5-13,16,19H,4,14-15,17-18H2,1-3H3 |
| InChIKey | TYMLYBRRTMZUQO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 123.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.06 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|