C35H28BrFN4O6 — CID 59158505
8-bromo-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(2-phenylmethoxyethyl)-1,5-naphthyridine-3-carboxamide (PubChem CID 59158505) has the molecular formula C35H28BrFN4O6 and a molecular weight of 699.53 g/mol. Its IUPAC name is 8-bromo-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(2-phenylmethoxyethyl)-1,5-naphthyridine-3-carboxamide.
| Compound Name | 8-bromo-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(2-phenylmethoxyethyl)-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 59158505 |
| Molecular Formula | C35H28BrFN4O6 |
| Molecular Weight | 699.53 g/mol |
| Exact Mass | 698.12 |
| IUPAC Name | 8-bromo-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-N-(2-phenylmethoxyethyl)-1,5-naphthyridine-3-carboxamide |
| SMILES | O=C(NCCOCc1ccccc1)c1c(O)c2ncc(Cc3ccc(F)cc3)c(Br)c2n(CCN2C(=O)c3ccccc3C2=O)c1=O |
| InChI | InChI=1S/C35H28BrFN4O6/c36-28-23(18-21-10-12-24(37)13-11-21)19-39-29-30(28)40(15-16-41-33(44)25-8-4-5-9-26(25)34(41)45)35(46)27(31(29)42)32(43)38-14-17-47-20-22-6-2-1-3-7-22/h1-13,19,42H,14-18,20H2,(H,38,43) |
| InChIKey | OMMXQABXSQIIAL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|