About (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate
(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate (PubChem CID 59158901) has the molecular formula C11H12F3NO5S2
and a molecular weight of 359.35 g/mol. Its IUPAC name is (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate |
| PubChem CID | 59158901 |
| Molecular Formula | C11H12F3NO5S2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate |
| SMILES | CS(=O)(=O)N1CCc2cc(OS(=O)(=O)C(F)(F)F)ccc2C1 |
| InChI | InChI=1S/C11H12F3NO5S2/c1-21(16,17)15-5-4-8-6-10(3-2-9(8)7-15)20-22(18,19)11(12,13)14/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | XCRHLNRZKAULPK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate?
The IUPAC name of (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate (CID 59158901) is (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate.
What is the SMILES notation for (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate?
The canonical SMILES for (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate is CS(=O)(=O)N1CCc2cc(OS(=O)(=O)C(F)(F)F)ccc2C1.
What is the InChIKey of (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate?
The InChIKey is XCRHLNRZKAULPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO5S2/c1-21(16,17)15-5-4-8-6-10(3-2-9(8)7-15)20-22(18,19)11(12,13)14/h2-3,6H,4-5,7H2,1H3.
What are the key properties of (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate?
(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate has a molecular weight of 359.35 g/mol, XLogP of 1.23, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl) trifluoromethanesulfonate is sourced from PubChem (CID 59158901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).