C26H34N4O2 — CID 59159030
tert-butyl N-[[3-[[3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methyl]carbamate (PubChem CID 59159030) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is tert-butyl N-[[3-[[3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59159030 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | tert-butyl N-[[3-[[3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(CN2CCCC(Cc3ccc4[nH]ncc4c3)C2)c1 |
| InChI | InChI=1S/C26H34N4O2/c1-26(2,3)32-25(31)27-15-20-6-4-7-21(13-20)17-30-11-5-8-22(18-30)12-19-9-10-24-23(14-19)16-28-29-24/h4,6-7,9-10,13-14,16,22H,5,8,11-12,15,17-18H2,1-3H3,(H,27,31)(H,28,29) |
| InChIKey | HIJAOOXBAOYEEI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |