C23H25N3O — CID 59159098
1-[4-[[3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]propan-2-one (PubChem CID 59159098) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[4-[[3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]propan-2-one.
| Compound Name | 1-[4-[[3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 59159098 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[4-[[3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]propan-2-one |
| SMILES | CC(=O)Cc1ccc(CN2CCC(Nc3cccc4cnccc34)C2)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-17(27)13-18-5-7-19(8-6-18)15-26-12-10-21(16-26)25-23-4-2-3-20-14-24-11-9-22(20)23/h2-9,11,14,21,25H,10,12-13,15-16H2,1H3 |
| InChIKey | KZBFZVPALPFZQF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |