C22H28N4O2S — CID 59159152
N-[3-[[3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]-N-methylmethanesulfonamide (PubChem CID 59159152) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[3-[[3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[3-[[3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 59159152 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[3-[[3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1cccc(CN2CCCC(Cc3ccc4[nH]ncc4c3)C2)c1)S(C)(=O)=O |
| InChI | InChI=1S/C22H28N4O2S/c1-25(29(2,27)28)21-7-3-5-19(13-21)16-26-10-4-6-18(15-26)11-17-8-9-22-20(12-17)14-23-24-22/h3,5,7-9,12-14,18H,4,6,10-11,15-16H2,1-2H3,(H,23,24) |
| InChIKey | VFWRVGYJFVXOFU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |