C22H30N4O3 — CID 59159326
5-[1-[(2Z)-cyclooct-2-en-1-yl]piperidin-4-yl]-7-methoxy-1H-pyrido[2,3-b][1,4]diazepine-2,4-dione (PubChem CID 59159326) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 5-[1-[(2Z)-cyclooct-2-en-1-yl]piperidin-4-yl]-7-methoxy-1H-pyrido[2,3-b][1,4]diazepine-2,4-dione.
| Compound Name | 5-[1-[(2Z)-cyclooct-2-en-1-yl]piperidin-4-yl]-7-methoxy-1H-pyrido[2,3-b][1,4]diazepine-2,4-dione |
|---|---|
| PubChem CID | 59159326 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 5-[1-[(2Z)-cyclooct-2-en-1-yl]piperidin-4-yl]-7-methoxy-1H-pyrido[2,3-b][1,4]diazepine-2,4-dione |
| SMILES | COc1ccc2c(n1)N(C1CCN(C3/C=C\CCCCC3)CC1)C(=O)CC(=O)N2 |
| InChI | InChI=1S/C22H30N4O3/c1-29-20-10-9-18-22(24-20)26(21(28)15-19(27)23-18)17-11-13-25(14-12-17)16-7-5-3-2-4-6-8-16/h5,7,9-10,16-17H,2-4,6,8,11-15H2,1H3,(H,23,27)/b7-5- |
| InChIKey | NEQQBFAZUUAWQM-ALCCZGGFSA-N |
| XLogP | 3.12 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|