C11H16N2O4S — CID 59159408
methyl 2-[(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]thiazine-4-carbonyl)amino]acetate (PubChem CID 59159408) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is methyl 2-[(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]thiazine-4-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]thiazine-4-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 59159408 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | methyl 2-[(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]thiazine-4-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)C1CSC(=O)C2CCCN12 |
| InChI | InChI=1S/C11H16N2O4S/c1-17-9(14)5-12-10(15)8-6-18-11(16)7-3-2-4-13(7)8/h7-8H,2-6H2,1H3,(H,12,15) |
| InChIKey | JTEXSLWEPIGKKC-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|