C23H27N7O5S2 — CID 59159569
(2S)-5-(diaminomethylideneamino)-2-[[3-[[3-(pyridin-2-ylmethylamino)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 59159569) has the molecular formula C23H27N7O5S2 and a molecular weight of 545.65 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-(pyridin-2-ylmethylamino)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-(pyridin-2-ylmethylamino)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59159569 |
| Molecular Formula | C23H27N7O5S2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-(pyridin-2-ylmethylamino)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc(NCc2ccccn2)c1)C(=O)O |
| InChI | InChI=1S/C23H27N7O5S2/c24-23(25)27-11-4-8-19(22(32)33)29-21(31)20-18(9-12-36-20)30-37(34,35)17-7-3-6-15(13-17)28-14-16-5-1-2-10-26-16/h1-3,5-7,9-10,12-13,19,28,30H,4,8,11,14H2,(H,29,31)(H,32,33)(H4,24,25,27)/t19-/m0/s1 |
| InChIKey | CDPTVBRXBDKYQV-IBGZPJMESA-N |
| XLogP | 1.79 |
| TPSA | 201.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|