C9H14N2 — CID 591596
3,3-dimethyl-4,7-dihydro-3aH-pyrazolo[1,5-a]pyridine (PubChem CID 591596) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,3-dimethyl-4,7-dihydro-3aH-pyrazolo[1,5-a]pyridine.
| Compound Name | 3,3-dimethyl-4,7-dihydro-3aH-pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 591596 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3,3-dimethyl-4,7-dihydro-3aH-pyrazolo[1,5-a]pyridine |
| SMILES | CC1(C)C=NN2CC=CCC21 |
| InChI | InChI=1S/C9H14N2/c1-9(2)7-10-11-6-4-3-5-8(9)11/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | BXJTWNMYRZFZST-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|