C26H28ClNO5S — CID 59159710
N-[3-[2-chloro-4-(4'-hydroxy-2'-oxospiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-furan]-3'-yl)-5-methylphenyl]phenyl]methanesulfonamide (PubChem CID 59159710) has the molecular formula C26H28ClNO5S and a molecular weight of 502.03 g/mol. Its IUPAC name is N-[3-[2-chloro-4-(4'-hydroxy-2'-oxospiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-furan]-3'-yl)-5-methylphenyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-chloro-4-(4'-hydroxy-2'-oxospiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-furan]-3'-yl)-5-methylphenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59159710 |
| Molecular Formula | C26H28ClNO5S |
| Molecular Weight | 502.03 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | N-[3-[2-chloro-4-(4'-hydroxy-2'-oxospiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-furan]-3'-yl)-5-methylphenyl]phenyl]methanesulfonamide |
| SMILES | Cc1cc(-c2cccc(NS(C)(=O)=O)c2)c(Cl)cc1C1=C(O)C2(CCC3CCCC3C2)OC1=O |
| InChI | InChI=1S/C26H28ClNO5S/c1-15-11-21(17-6-4-8-19(12-17)28-34(2,31)32)22(27)13-20(15)23-24(29)26(33-25(23)30)10-9-16-5-3-7-18(16)14-26/h4,6,8,11-13,16,18,28-29H,3,5,7,9-10,14H2,1-2H3 |
| InChIKey | YEBQBOHVRJLYTG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.03 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |