C38H42N4O4S4 — CID 59159875
4-[[4-[(2S,3R)-4-[3,4-bis[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-2,3-dimethylbutyl]-2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenoxy]methyl]-2-methyl-1,3-thiazole (PubChem CID 59159875) has the molecular formula C38H42N4O4S4 and a molecular weight of 747.05 g/mol. Its IUPAC name is 4-[[4-[(2S,3R)-4-[3,4-bis[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-2,3-dimethylbutyl]-2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenoxy]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[4-[(2S,3R)-4-[3,4-bis[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-2,3-dimethylbutyl]-2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenoxy]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 59159875 |
| Molecular Formula | C38H42N4O4S4 |
| Molecular Weight | 747.05 g/mol |
| Exact Mass | 746.21 |
| IUPAC Name | 4-[[4-[(2S,3R)-4-[3,4-bis[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-2,3-dimethylbutyl]-2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenoxy]methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(COc2ccc(C[C@@H](C)[C@@H](C)Cc3ccc(OCc4csc(C)n4)c(OCc4csc(C)n4)c3)cc2OCc2csc(C)n2)cs1 |
| InChI | InChI=1S/C38H42N4O4S4/c1-23(11-29-7-9-35(43-15-31-19-47-25(3)39-31)37(13-29)45-17-33-21-49-27(5)41-33)24(2)12-30-8-10-36(44-16-32-20-48-26(4)40-32)38(14-30)46-18-34-22-50-28(6)42-34/h7-10,13-14,19-24H,11-12,15-18H2,1-6H3/t23-,24+ |
| InChIKey | LDFYTAHPKMQQKY-PSWAGMNNSA-N |
| XLogP | 10.12 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.05 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |