C20H11Cl2NO3S — CID 59160805
3-[4-[2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetyl]phenyl]prop-2-ynoic acid (PubChem CID 59160805) has the molecular formula C20H11Cl2NO3S and a molecular weight of 416.29 g/mol. Its IUPAC name is 3-[4-[2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetyl]phenyl]prop-2-ynoic acid.
| Compound Name | 3-[4-[2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetyl]phenyl]prop-2-ynoic acid |
|---|---|
| PubChem CID | 59160805 |
| Molecular Formula | C20H11Cl2NO3S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | 3-[4-[2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetyl]phenyl]prop-2-ynoic acid |
| SMILES | O=C(O)C#Cc1ccc(C(=O)Cc2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C20H11Cl2NO3S/c21-15-7-6-14(9-16(15)22)17-11-27-19(23-17)10-18(24)13-4-1-12(2-5-13)3-8-20(25)26/h1-2,4-7,9,11H,10H2,(H,25,26) |
| InChIKey | WTEGVNYPWPKYGQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|