C24H20N4O3S2 — CID 59160976
4-[4-[[3-cyano-5-isocyano-6-methyl-4-(oxan-2-yl)-2-pyridinyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzoic acid (PubChem CID 59160976) has the molecular formula C24H20N4O3S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 4-[4-[[3-cyano-5-isocyano-6-methyl-4-(oxan-2-yl)-2-pyridinyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 4-[4-[[3-cyano-5-isocyano-6-methyl-4-(oxan-2-yl)-2-pyridinyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 59160976 |
| Molecular Formula | C24H20N4O3S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 4-[4-[[3-cyano-5-isocyano-6-methyl-4-(oxan-2-yl)-2-pyridinyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzoic acid |
| SMILES | [C-]#[N+]c1c(C)nc(SCc2csc(-c3ccc(C(=O)O)cc3)n2)c(C#N)c1C1CCCCO1 |
| InChI | InChI=1S/C24H20N4O3S2/c1-14-21(26-2)20(19-5-3-4-10-31-19)18(11-25)23(27-14)33-13-17-12-32-22(28-17)15-6-8-16(9-7-15)24(29)30/h6-9,12,19H,3-5,10,13H2,1H3,(H,29,30) |
| InChIKey | BGIXQBYKNNXCPF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|