C20H27N3O4 — CID 59161816
4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzoic acid (PubChem CID 59161816) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzoic acid.
| Compound Name | 4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 59161816 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzoic acid |
| SMILES | CC(C)c1noc(N2CCC(CCCOc3ccc(C(=O)O)cc3)CC2)n1 |
| InChI | InChI=1S/C20H27N3O4/c1-14(2)18-21-20(27-22-18)23-11-9-15(10-12-23)4-3-13-26-17-7-5-16(6-8-17)19(24)25/h5-8,14-15H,3-4,9-13H2,1-2H3,(H,24,25) |
| InChIKey | GPOWKAZKTLAXOI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|