About 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol
1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol (PubChem CID 59162010) has the molecular formula C19H25N5O
and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol.
Molecular Properties
| Compound Name | 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol |
| PubChem CID | 59162010 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol |
| SMILES | CC(C)(C)Cc1cnc(CC(C)(O)c2ccc(-n3nccn3)cc2)[nH]1 |
| InChI | InChI=1S/C19H25N5O/c1-18(2,3)11-15-13-20-17(23-15)12-19(4,25)14-5-7-16(8-6-14)24-21-9-10-22-24/h5-10,13,25H,11-12H2,1-4H3,(H,20,23) |
| InChIKey | PKLGAGRKFAKNDU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol?
The IUPAC name of 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol (CID 59162010) is 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol.
What is the SMILES notation for 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol?
The canonical SMILES for 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol is CC(C)(C)Cc1cnc(CC(C)(O)c2ccc(-n3nccn3)cc2)[nH]1.
What is the InChIKey of 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol?
The InChIKey is PKLGAGRKFAKNDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5O/c1-18(2,3)11-15-13-20-17(23-15)12-19(4,25)14-5-7-16(8-6-14)24-21-9-10-22-24/h5-10,13,25H,11-12H2,1-4H3,(H,20,23).
What are the key properties of 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol?
1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol has a molecular weight of 339.44 g/mol, XLogP of 3.03, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,2-dimethylpropyl)-1H-imidazol-2-yl]-2-[4-(triazol-2-yl)phenyl]propan-2-ol is sourced from PubChem (CID 59162010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).