C32H41F2N3O5S — CID 59162214
3-[2-[3-ethyl-4-[[(2R)-3-[[5-(3-fluoro-4-pyridinyl)-2-methylpentan-2-yl]amino]-2-hydroxypropyl]-methylsulfamoyl]phenyl]-3-fluorophenyl]propanoic acid (PubChem CID 59162214) has the molecular formula C32H41F2N3O5S and a molecular weight of 617.76 g/mol. Its IUPAC name is 3-[2-[3-ethyl-4-[[(2R)-3-[[5-(3-fluoro-4-pyridinyl)-2-methylpentan-2-yl]amino]-2-hydroxypropyl]-methylsulfamoyl]phenyl]-3-fluorophenyl]propanoic acid.
| Compound Name | 3-[2-[3-ethyl-4-[[(2R)-3-[[5-(3-fluoro-4-pyridinyl)-2-methylpentan-2-yl]amino]-2-hydroxypropyl]-methylsulfamoyl]phenyl]-3-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 59162214 |
| Molecular Formula | C32H41F2N3O5S |
| Molecular Weight | 617.76 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | 3-[2-[3-ethyl-4-[[(2R)-3-[[5-(3-fluoro-4-pyridinyl)-2-methylpentan-2-yl]amino]-2-hydroxypropyl]-methylsulfamoyl]phenyl]-3-fluorophenyl]propanoic acid |
| SMILES | CCc1cc(-c2c(F)cccc2CCC(=O)O)ccc1S(=O)(=O)N(C)C[C@H](O)CNC(C)(C)CCCc1ccncc1F |
| InChI | InChI=1S/C32H41F2N3O5S/c1-5-22-18-25(31-24(12-14-30(39)40)8-6-10-27(31)33)11-13-29(22)43(41,42)37(4)21-26(38)19-36-32(2,3)16-7-9-23-15-17-35-20-28(23)34/h6,8,10-11,13,15,17-18,20,26,36,38H,5,7,9,12,14,16,19,21H2,1-4H3,(H,39,40)/t26-/m1/s1 |
| InChIKey | UIMOTOAYIPYVBD-AREMUKBSSA-N |
| XLogP | 4.98 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |