C18H21N3O7 — CID 59163130
(2,5-dioxopyrrolidin-1-yl) 2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]acetate (PubChem CID 59163130) has the molecular formula C18H21N3O7 and a molecular weight of 391.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]acetate |
|---|---|
| PubChem CID | 59163130 |
| Molecular Formula | C18H21N3O7 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]acetate |
| SMILES | O=C(CNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H21N3O7/c22-13-5-6-14(23)20(13)10-11-1-3-12(4-2-11)18(27)19-9-17(26)28-21-15(24)7-8-16(21)25/h5-6,11-12H,1-4,7-10H2,(H,19,27) |
| InChIKey | MMSLCECHPKJLTJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|