About dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine
dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine (PubChem CID 59163589) has the molecular formula C19H19Cl2CoN3+
and a molecular weight of 419.22 g/mol. Its IUPAC name is dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine.
Molecular Properties
| Compound Name | dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine |
| PubChem CID | 59163589 |
| Molecular Formula | C19H19Cl2CoN3+ |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine |
| SMILES | CN(CC1=Nc2ccccc2C1)CC1=Nc2ccccc2C1.Cl[Co+]Cl |
| InChI | InChI=1S/C19H19N3.2ClH.Co/c1-22(12-16-10-14-6-2-4-8-18(14)20-16)13-17-11-15-7-3-5-9-19(15)21-17;;;/h2-9H,10-13H2,1H3;2*1H;/q;;;+3/p-2 |
| InChIKey | ROSOPDXWTNGHKC-UHFFFAOYSA-L |
| XLogP | 4.95 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine?
The IUPAC name of dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine (CID 59163589) is dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine.
What is the SMILES notation for dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine?
The canonical SMILES for dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine is CN(CC1=Nc2ccccc2C1)CC1=Nc2ccccc2C1.Cl[Co+]Cl.
What is the InChIKey of dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine?
The InChIKey is ROSOPDXWTNGHKC-UHFFFAOYSA-L. The full InChI is InChI=1S/C19H19N3.2ClH.Co/c1-22(12-16-10-14-6-2-4-8-18(14)20-16)13-17-11-15-7-3-5-9-19(15)21-17;;;/h2-9H,10-13H2,1H3;2*1H;/q;;;+3/p-2.
What are the key properties of dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine?
dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine has a molecular weight of 419.22 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocobalt(1+);1-(3H-indol-2-yl)-N-(3H-indol-2-ylmethyl)-N-methylmethanamine is sourced from PubChem (CID 59163589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).