C11H23NS — CID 59163891
(2R,3S)-2,3-diethyl-4,5,6-trimethylthiomorpholine (PubChem CID 59163891) has the molecular formula C11H23NS and a molecular weight of 201.38 g/mol. Its IUPAC name is (2R,3S)-2,3-diethyl-4,5,6-trimethylthiomorpholine.
| Compound Name | (2R,3S)-2,3-diethyl-4,5,6-trimethylthiomorpholine |
|---|---|
| PubChem CID | 59163891 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | (2R,3S)-2,3-diethyl-4,5,6-trimethylthiomorpholine |
| SMILES | CC[C@H]1SC(C)C(C)N(C)[C@H]1CC |
| InChI | InChI=1S/C11H23NS/c1-6-10-11(7-2)13-9(4)8(3)12(10)5/h8-11H,6-7H2,1-5H3/t8?,9?,10-,11+/m0/s1 |
| InChIKey | NEKLCGIHFZLERH-WFBLGPOFSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |