About 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole
4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole (PubChem CID 59163899) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole |
| PubChem CID | 59163899 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole |
| SMILES | CCC1=C(CC)NC(C)C1 |
| InChI | InChI=1S/C9H17N/c1-4-8-6-7(3)10-9(8)5-2/h7,10H,4-6H2,1-3H3 |
| InChIKey | SJIXUNHDEIIAEP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole?
The IUPAC name of 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole (CID 59163899) is 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole is CCC1=C(CC)NC(C)C1.
What is the InChIKey of 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole?
The InChIKey is SJIXUNHDEIIAEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-4-8-6-7(3)10-9(8)5-2/h7,10H,4-6H2,1-3H3.
What are the key properties of 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole?
4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole has a molecular weight of 139.24 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethyl-2-methyl-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 59163899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).