C22H21BrN4+2 — CID 59164051
25-bromo-6,14-diaza-3,17-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),3(26),4,8(25),9,11,15,17(24),19,21-decaene (PubChem CID 59164051) has the molecular formula C22H21BrN4+2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 25-bromo-6,14-diaza-3,17-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),3(26),4,8(25),9,11,15,17(24),19,21-decaene.
| Compound Name | 25-bromo-6,14-diaza-3,17-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),3(26),4,8(25),9,11,15,17(24),19,21-decaene |
|---|---|
| PubChem CID | 59164051 |
| Molecular Formula | C22H21BrN4+2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 25-bromo-6,14-diaza-3,17-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),3(26),4,8(25),9,11,15,17(24),19,21-decaene |
| SMILES | Brc1c2cccc1Cn1cc[n+](c1)Cc1cccc(c1)C[n+]1ccn(c1)C2 |
| InChI | InChI=1S/C22H21BrN4/c23-22-20-5-2-6-21(22)15-27-10-8-25(17-27)13-19-4-1-3-18(11-19)12-24-7-9-26(14-20)16-24/h1-11,16-17H,12-15H2/q+2 |
| InChIKey | GJLKKRGWMOHCRD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|