About N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide
N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide (PubChem CID 59164428) has the molecular formula C14H13N5O4S
and a molecular weight of 347.36 g/mol. Its IUPAC name is N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide |
| PubChem CID | 59164428 |
| Molecular Formula | C14H13N5O4S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide |
| SMILES | Cc1cc2[nH]c(=O)n(NS(C)(=O)=O)c(=O)c2cc1-c1cccnn1 |
| InChI | InChI=1S/C14H13N5O4S/c1-8-6-12-10(7-9(8)11-4-3-5-15-17-11)13(20)19(14(21)16-12)18-24(2,22)23/h3-7,18H,1-2H3,(H,16,21) |
| InChIKey | WZEIEMAWVCWLPL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide?
The IUPAC name of N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide (CID 59164428) is N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide.
What is the SMILES notation for N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide?
The canonical SMILES for N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide is Cc1cc2[nH]c(=O)n(NS(C)(=O)=O)c(=O)c2cc1-c1cccnn1.
What is the InChIKey of N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide?
The InChIKey is WZEIEMAWVCWLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5O4S/c1-8-6-12-10(7-9(8)11-4-3-5-15-17-11)13(20)19(14(21)16-12)18-24(2,22)23/h3-7,18H,1-2H3,(H,16,21).
What are the key properties of N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide?
N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide has a molecular weight of 347.36 g/mol, XLogP of -0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-methyl-2,4-dioxo-6-pyridazin-3-yl-1H-quinazolin-3-yl)methanesulfonamide is sourced from PubChem (CID 59164428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).