About N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide
N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide (PubChem CID 59164451) has the molecular formula C16H23N3O5S
and a molecular weight of 369.44 g/mol. Its IUPAC name is N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide |
| PubChem CID | 59164451 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide |
| SMILES | CCCOC(CC)c1cc2c(=O)n(NS(C)(=O)=O)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C16H23N3O5S/c1-5-7-24-14(6-2)11-9-12-13(8-10(11)3)17-16(21)19(15(12)20)18-25(4,22)23/h8-9,14,18H,5-7H2,1-4H3,(H,17,21) |
| InChIKey | ZATDQJKIXBPNRF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide?
The IUPAC name of N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide (CID 59164451) is N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide.
What is the SMILES notation for N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide?
The canonical SMILES for N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide is CCCOC(CC)c1cc2c(=O)n(NS(C)(=O)=O)c(=O)[nH]c2cc1C.
What is the InChIKey of N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide?
The InChIKey is ZATDQJKIXBPNRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O5S/c1-5-7-24-14(6-2)11-9-12-13(8-10(11)3)17-16(21)19(15(12)20)18-25(4,22)23/h8-9,14,18H,5-7H2,1-4H3,(H,17,21).
What are the key properties of N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide?
N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide has a molecular weight of 369.44 g/mol, XLogP of 1.38, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-methyl-2,4-dioxo-6-(1-propoxypropyl)-1H-quinazolin-3-yl]methanesulfonamide is sourced from PubChem (CID 59164451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).