C14H13NO2S — CID 59164668
2-(2-sulfanylphenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 59164668) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(2-sulfanylphenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(2-sulfanylphenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 59164668 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-(2-sulfanylphenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1c1ccccc1S |
| InChI | InChI=1S/C14H13NO2S/c16-13-9-5-1-2-6-10(9)14(17)15(13)11-7-3-4-8-12(11)18/h1-4,7-10,18H,5-6H2 |
| InChIKey | YBECMNJVIMVMOJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|