C15H14O3 — CID 59164690
(2R,6S,8R)-8-phenyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 59164690) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is (2R,6S,8R)-8-phenyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (2R,6S,8R)-8-phenyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 59164690 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (2R,6S,8R)-8-phenyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1OC(=O)[C@H]2C3CC(C[C@H]3c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C15H14O3/c16-14-12-9-6-10(8-4-2-1-3-5-8)11(7-9)13(12)15(17)18-14/h1-5,9-13H,6-7H2/t9?,10-,11?,12+,13-/m0/s1 |
| InChIKey | QVZKCYULUXLGPJ-TXTTUAKNSA-N |
| XLogP | 2.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|