C24H21BrN2O3 — CID 59164724
2-[(2R,6S)-4-(4-bromo-3-methylphenyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-2-yl]-N-phenylacetamide (PubChem CID 59164724) has the molecular formula C24H21BrN2O3 and a molecular weight of 465.35 g/mol. Its IUPAC name is 2-[(2R,6S)-4-(4-bromo-3-methylphenyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-2-yl]-N-phenylacetamide.
| Compound Name | 2-[(2R,6S)-4-(4-bromo-3-methylphenyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 59164724 |
| Molecular Formula | C24H21BrN2O3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 2-[(2R,6S)-4-(4-bromo-3-methylphenyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-2-yl]-N-phenylacetamide |
| SMILES | Cc1cc(N2C(=O)[C@H]3C4C=CC(C4)[C@@]3(CC(=O)Nc3ccccc3)C2=O)ccc1Br |
| InChI | InChI=1S/C24H21BrN2O3/c1-14-11-18(9-10-19(14)25)27-22(29)21-15-7-8-16(12-15)24(21,23(27)30)13-20(28)26-17-5-3-2-4-6-17/h2-11,15-16,21H,12-13H2,1H3,(H,26,28)/t15?,16?,21-,24-/m1/s1 |
| InChIKey | AQHCWWUDVJWSGC-GWACABGHSA-N |
| XLogP | 4.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|