C15H16O4 — CID 59164805
(2R,3S,5R)-5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 59164805) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2R,3S,5R)-5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
| Compound Name | (2R,3S,5R)-5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 59164805 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (2R,3S,5R)-5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1C2CC([C@H](c3ccccc3)C2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C15H16O4/c16-14(17)12-9-6-10(8-4-2-1-3-5-8)11(7-9)13(12)15(18)19/h1-5,9-13H,6-7H2,(H,16,17)(H,18,19)/t9?,10-,11?,12+,13-/m0/s1 |
| InChIKey | FVOPGJHWZNSVSQ-TXTTUAKNSA-N |
| XLogP | 2.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |