About tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate
tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate (PubChem CID 59164846) has the molecular formula C23H27FN2O4
and a molecular weight of 414.48 g/mol. Its IUPAC name is tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate |
| PubChem CID | 59164846 |
| Molecular Formula | C23H27FN2O4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](c2ccc(OCc3ccccc3F)cc2)CC[C@H]1C(N)=O |
| InChI | InChI=1S/C23H27FN2O4/c1-23(2,3)30-22(28)26-19(12-13-20(26)21(25)27)15-8-10-17(11-9-15)29-14-16-6-4-5-7-18(16)24/h4-11,19-20H,12-14H2,1-3H3,(H2,25,27)/t19-,20+/m1/s1 |
| InChIKey | VUNSHVRUNXKELQ-UXHICEINSA-N |
| XLogP | 4.33 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate (CID 59164846) is tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1[C@@H](c2ccc(OCc3ccccc3F)cc2)CC[C@H]1C(N)=O.
What is the InChIKey of tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate?
The InChIKey is VUNSHVRUNXKELQ-UXHICEINSA-N. The full InChI is InChI=1S/C23H27FN2O4/c1-23(2,3)30-22(28)26-19(12-13-20(26)21(25)27)15-8-10-17(11-9-15)29-14-16-6-4-5-7-18(16)24/h4-11,19-20H,12-14H2,1-3H3,(H2,25,27)/t19-,20+/m1/s1.
What are the key properties of tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate?
tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate has a molecular weight of 414.48 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,5R)-2-carbamoyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 59164846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).