About 3-methyl-2-methylidene-1,3-thiazinane
3-methyl-2-methylidene-1,3-thiazinane (PubChem CID 59164986) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is 3-methyl-2-methylidene-1,3-thiazinane.
Molecular Properties
| Compound Name | 3-methyl-2-methylidene-1,3-thiazinane |
| PubChem CID | 59164986 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 3-methyl-2-methylidene-1,3-thiazinane |
| SMILES | C=C1SCCCN1C |
| InChI | InChI=1S/C6H11NS/c1-6-7(2)4-3-5-8-6/h1,3-5H2,2H3 |
| InChIKey | WXRGGMVJSCJHHT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2-methylidene-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-methylidene-1,3-thiazinane?
The IUPAC name of 3-methyl-2-methylidene-1,3-thiazinane (CID 59164986) is 3-methyl-2-methylidene-1,3-thiazinane.
What is the SMILES notation for 3-methyl-2-methylidene-1,3-thiazinane?
The canonical SMILES for 3-methyl-2-methylidene-1,3-thiazinane is C=C1SCCCN1C.
What is the InChIKey of 3-methyl-2-methylidene-1,3-thiazinane?
The InChIKey is WXRGGMVJSCJHHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS/c1-6-7(2)4-3-5-8-6/h1,3-5H2,2H3.
What are the key properties of 3-methyl-2-methylidene-1,3-thiazinane?
3-methyl-2-methylidene-1,3-thiazinane has a molecular weight of 129.23 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-methylidene-1,3-thiazinane is sourced from PubChem (CID 59164986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).