About 3-methyl-2-methylidene-1,3-thiazole
3-methyl-2-methylidene-1,3-thiazole (PubChem CID 59165032) has the molecular formula C5H7NS
and a molecular weight of 113.18 g/mol. Its IUPAC name is 3-methyl-2-methylidene-1,3-thiazole.
Molecular Properties
| Compound Name | 3-methyl-2-methylidene-1,3-thiazole |
| PubChem CID | 59165032 |
| Molecular Formula | C5H7NS |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.03 |
| IUPAC Name | 3-methyl-2-methylidene-1,3-thiazole |
| SMILES | C=C1SC=CN1C |
| InChI | InChI=1S/C5H7NS/c1-5-6(2)3-4-7-5/h3-4H,1H2,2H3 |
| InChIKey | AANXTOHGCJZOKQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2-methylidene-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-methylidene-1,3-thiazole?
The IUPAC name of 3-methyl-2-methylidene-1,3-thiazole (CID 59165032) is 3-methyl-2-methylidene-1,3-thiazole.
What is the SMILES notation for 3-methyl-2-methylidene-1,3-thiazole?
The canonical SMILES for 3-methyl-2-methylidene-1,3-thiazole is C=C1SC=CN1C.
What is the InChIKey of 3-methyl-2-methylidene-1,3-thiazole?
The InChIKey is AANXTOHGCJZOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NS/c1-5-6(2)3-4-7-5/h3-4H,1H2,2H3.
What are the key properties of 3-methyl-2-methylidene-1,3-thiazole?
3-methyl-2-methylidene-1,3-thiazole has a molecular weight of 113.18 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-methylidene-1,3-thiazole is sourced from PubChem (CID 59165032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).