About 1,3-dimethyldiazepine
1,3-dimethyldiazepine (PubChem CID 59165049) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 1,3-dimethyldiazepine.
Molecular Properties
| Compound Name | 1,3-dimethyldiazepine |
| PubChem CID | 59165049 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 1,3-dimethyldiazepine |
| SMILES | CC1=NN(C)C=CC=C1 |
| InChI | InChI=1S/C7H10N2/c1-7-5-3-4-6-9(2)8-7/h3-6H,1-2H3 |
| InChIKey | ZCQCZBXHBUEIQQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyldiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyldiazepine?
The IUPAC name of 1,3-dimethyldiazepine (CID 59165049) is 1,3-dimethyldiazepine.
What is the SMILES notation for 1,3-dimethyldiazepine?
The canonical SMILES for 1,3-dimethyldiazepine is CC1=NN(C)C=CC=C1.
What is the InChIKey of 1,3-dimethyldiazepine?
The InChIKey is ZCQCZBXHBUEIQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-7-5-3-4-6-9(2)8-7/h3-6H,1-2H3.
What are the key properties of 1,3-dimethyldiazepine?
1,3-dimethyldiazepine has a molecular weight of 122.17 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyldiazepine is sourced from PubChem (CID 59165049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).