C10H14N2S — CID 59165072
2,3-dimethyl-1-methylidene-4H-1λ4,2,3-benzothiadiazine (PubChem CID 59165072) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 2,3-dimethyl-1-methylidene-4H-1λ4,2,3-benzothiadiazine.
| Compound Name | 2,3-dimethyl-1-methylidene-4H-1λ4,2,3-benzothiadiazine |
|---|---|
| PubChem CID | 59165072 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2,3-dimethyl-1-methylidene-4H-1λ4,2,3-benzothiadiazine |
| SMILES | C=S1c2ccccc2CN(C)N1C |
| InChI | InChI=1S/C10H14N2S/c1-11-8-9-6-4-5-7-10(9)13(3)12(11)2/h4-7H,3,8H2,1-2H3 |
| InChIKey | VSNQILSAFHPNEY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|